C16H10ClF3INO4 — CID 55313512
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55313512) has the molecular formula C16H10ClF3INO4 and a molecular weight of 499.61 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55313512 |
| Molecular Formula | C16H10ClF3INO4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 498.93 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(I)o1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10ClF3INO4/c17-9-1-4-12(11(7-9)16(18,19)20)22-14(23)8-25-15(24)6-3-10-2-5-13(21)26-10/h1-7H,8H2,(H,22,23)/b6-3+ |
| InChIKey | FSSSOGMUCXXULY-ZZXKWVIFSA-N |
| XLogP | 4.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|