C19H16N6O2S — CID 7261394
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(tetrazol-1-yl)benzoate (PubChem CID 7261394) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7261394 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(tetrazol-1-yl)benzoate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)c3ccccc3-n3cnnn3)cs2)cc1 |
| InChI | InChI=1S/C19H16N6O2S/c1-13-6-8-14(9-7-13)21-19-22-15(11-28-19)10-27-18(26)16-4-2-3-5-17(16)25-12-20-23-24-25/h2-9,11-12H,10H2,1H3,(H,21,22) |
| InChIKey | UAOLLQIKEJXIDY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |