C10H15NO2S — CID 70669978
(4-methyl-1,3-thiazol-2-yl)methyl pentanoate (PubChem CID 70669978) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methyl pentanoate.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)methyl pentanoate |
|---|---|
| PubChem CID | 70669978 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)methyl pentanoate |
| SMILES | CCCCC(=O)OCc1nc(C)cs1 |
| InChI | InChI=1S/C10H15NO2S/c1-3-4-5-10(12)13-6-9-11-8(2)7-14-9/h7H,3-6H2,1-2H3 |
| InChIKey | USMDGLQXAPHOOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |