C14H22N2O4S2 — CID 71128791
butyl (2R)-3-methylsulfanyl-2-[(4-methyl-1,3-thiazol-2-yl)methoxycarbonylamino]propanoate (PubChem CID 71128791) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is butyl (2R)-3-methylsulfanyl-2-[(4-methyl-1,3-thiazol-2-yl)methoxycarbonylamino]propanoate.
| Compound Name | butyl (2R)-3-methylsulfanyl-2-[(4-methyl-1,3-thiazol-2-yl)methoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 71128791 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | butyl (2R)-3-methylsulfanyl-2-[(4-methyl-1,3-thiazol-2-yl)methoxycarbonylamino]propanoate |
| SMILES | CCCCOC(=O)[C@H](CSC)NC(=O)OCc1nc(C)cs1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-4-5-6-19-13(17)11(9-21-3)16-14(18)20-7-12-15-10(2)8-22-12/h8,11H,4-7,9H2,1-3H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | LYXMRSVUMRKVJE-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|