C19H14N4O2S — CID 86826373
(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-pyrazol-1-ylbenzoate (PubChem CID 86826373) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-pyrazol-1-ylbenzoate.
| Compound Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 86826373 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-pyrazol-1-ylbenzoate |
| SMILES | O=C(OCc1csc(-c2ccccn2)n1)c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C19H14N4O2S/c24-19(15-6-1-2-8-17(15)23-11-5-10-21-23)25-12-14-13-26-18(22-14)16-7-3-4-9-20-16/h1-11,13H,12H2 |
| InChIKey | WSUMTOMGOXVMNZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |