C17H20N4O2S — CID 74807877
(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate (PubChem CID 74807877) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate.
| Compound Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 74807877 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccn2)n1)C1NNC2CCCCC21 |
| InChI | InChI=1S/C17H20N4O2S/c22-17(15-12-5-1-2-6-13(12)20-21-15)23-9-11-10-24-16(19-11)14-7-3-4-8-18-14/h3-4,7-8,10,12-13,15,20-21H,1-2,5-6,9H2 |
| InChIKey | WKYSPNIRJSHVLH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |