C17H21N3OS — CID 110627595
N-(cyclopentylmethyl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)propanamide (PubChem CID 110627595) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(cyclopentylmethyl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110627595 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(cyclopentylmethyl)-3-(2-pyridin-2-yl-1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(CCc1csc(-c2ccccn2)n1)NCC1CCCC1 |
| InChI | InChI=1S/C17H21N3OS/c21-16(19-11-13-5-1-2-6-13)9-8-14-12-22-17(20-14)15-7-3-4-10-18-15/h3-4,7,10,12-13H,1-2,5-6,8-9,11H2,(H,19,21) |
| InChIKey | DVIALPXVKNLPGJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |