C21H22N4OS — CID 110329830
3-(2-pyridin-2-yl-1,3-thiazol-4-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 110329830) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-(2-pyridin-2-yl-1,3-thiazol-4-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-(2-pyridin-2-yl-1,3-thiazol-4-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 110329830 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-(2-pyridin-2-yl-1,3-thiazol-4-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | O=C(CCc1csc(-c2ccccn2)n1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C21H22N4OS/c26-20(23-16-6-9-18(10-7-16)25-13-3-4-14-25)11-8-17-15-27-21(24-17)19-5-1-2-12-22-19/h1-2,5-7,9-10,12,15H,3-4,8,11,13-14H2,(H,23,26) |
| InChIKey | DTHCBYDLSGVJGV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|