C24H27N3O2S — CID 16590997
2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 16590997) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 16590997 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)Nc2ccc(N3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C24H27N3O2S/c1-2-29-22-9-5-4-8-21(22)24-26-19(17-30-24)16-23(28)25-18-10-12-20(13-11-18)27-14-6-3-7-15-27/h4-5,8-13,17H,2-3,6-7,14-16H2,1H3,(H,25,28) |
| InChIKey | XTDSFCYFMXBALP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|