C25H29N3O4S2 — CID 16595528
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 16595528) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 16595528 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[2-(2-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1ccccc1-c1nc(CC(=O)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cs1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-2-32-23-10-6-5-9-22(23)25-27-20(18-33-25)17-24(29)26-19-11-13-21(14-12-19)34(30,31)28-15-7-3-4-8-16-28/h5-6,9-14,18H,2-4,7-8,15-17H2,1H3,(H,26,29) |
| InChIKey | AIGZASQJFAZLCW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |