C17H21N3OS — CID 110388522
3-(4-methyl-1,3-thiazol-2-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 110388522) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-2-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 110388522 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1csc(CCC(=O)Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C17H21N3OS/c1-13-12-22-17(18-13)9-8-16(21)19-14-4-6-15(7-5-14)20-10-2-3-11-20/h4-7,12H,2-3,8-11H2,1H3,(H,19,21) |
| InChIKey | AAMIVJGBFOWCST-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|