C24H19N3O3S2 — CID 30760630
(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 30760630) has the molecular formula C24H19N3O3S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 30760630 |
| Molecular Formula | C24H19N3O3S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccn2)n1)c1c(-c2ccccc2)csc1NC(=O)C1CC1 |
| InChI | InChI=1S/C24H19N3O3S2/c28-21(16-9-10-16)27-23-20(18(14-32-23)15-6-2-1-3-7-15)24(29)30-12-17-13-31-22(26-17)19-8-4-5-11-25-19/h1-8,11,13-14,16H,9-10,12H2,(H,27,28) |
| InChIKey | HBDFEJIEURWFAD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|