C23H17FN2O3S — CID 24577275
(5-cyano-2-fluorophenyl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 24577275) has the molecular formula C23H17FN2O3S and a molecular weight of 420.47 g/mol. Its IUPAC name is (5-cyano-2-fluorophenyl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | (5-cyano-2-fluorophenyl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 24577275 |
| Molecular Formula | C23H17FN2O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (5-cyano-2-fluorophenyl)methyl 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | N#Cc1ccc(F)c(COC(=O)c2c(-c3ccccc3)csc2NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C23H17FN2O3S/c24-19-9-6-14(11-25)10-17(19)12-29-23(28)20-18(15-4-2-1-3-5-15)13-30-22(20)26-21(27)16-7-8-16/h1-6,9-10,13,16H,7-8,12H2,(H,26,27) |
| InChIKey | FFFYINSTNJZMNB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|