C24H20N2O6S — CID 23732804
ethyl 2-[[2-[2-(4-cyanophenoxy)acetyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 23732804) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(4-cyanophenoxy)acetyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(4-cyanophenoxy)acetyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23732804 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | ethyl 2-[[2-[2-(4-cyanophenoxy)acetyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COC(=O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H20N2O6S/c1-2-30-24(29)22-19(17-6-4-3-5-7-17)15-33-23(22)26-20(27)13-32-21(28)14-31-18-10-8-16(12-25)9-11-18/h3-11,15H,2,13-14H2,1H3,(H,26,27) |
| InChIKey | MJUIKQUTLHHCTI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|