C23H20N2O5S — CID 16511725
ethyl 2-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 16511725) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is ethyl 2-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16511725 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | ethyl 2-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COc1ccc(C#N)cc1OC |
| InChI | InChI=1S/C23H20N2O5S/c1-3-29-23(27)21-17(16-7-5-4-6-8-16)14-31-22(21)25-20(26)13-30-18-10-9-15(12-24)11-19(18)28-2/h4-11,14H,3,13H2,1-2H3,(H,25,26) |
| InChIKey | IWWCJUYBTNIBRI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|