C22H26N2O4S — CID 7791906
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 7791906) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7791906 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)c1c(-c2ccccc2)csc1NC(=O)C1CC1 |
| InChI | InChI=1S/C22H26N2O4S/c1-3-7-14(2)23-18(25)12-28-22(27)19-17(15-8-5-4-6-9-15)13-29-21(19)24-20(26)16-10-11-16/h4-6,8-9,13-14,16H,3,7,10-12H2,1-2H3,(H,23,25)(H,24,26)/t14-/m0/s1 |
| InChIKey | VDXCCLRUNWNKKD-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|