C18H22N2O4S2 — CID 7791813
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 7791813) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7791813 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)c1c(-c2cccs2)csc1NC(C)=O |
| InChI | InChI=1S/C18H22N2O4S2/c1-4-6-11(2)19-15(22)9-24-18(23)16-13(14-7-5-8-25-14)10-26-17(16)20-12(3)21/h5,7-8,10-11H,4,6,9H2,1-3H3,(H,19,22)(H,20,21)/t11-/m1/s1 |
| InChIKey | DUBMZIQYSBIZRU-LLVKDONJSA-N |
| XLogP | 3.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|