C17H20N2O5S2 — CID 8975394
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 8975394) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8975394 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1c(-c2cccs2)csc1NC(C)=O |
| InChI | InChI=1S/C17H20N2O5S2/c1-10(15(21)18-6-7-23-3)24-17(22)14-12(13-5-4-8-25-13)9-26-16(14)19-11(2)20/h4-5,8-10H,6-7H2,1-3H3,(H,18,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | QAPMUIFKAVXMGW-JTQLQIEISA-N |
| XLogP | 2.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|