C16H11BrN2O3S2 — CID 23611145
methyl 2-[(5-bromopyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 23611145) has the molecular formula C16H11BrN2O3S2 and a molecular weight of 423.31 g/mol. Its IUPAC name is methyl 2-[(5-bromopyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-bromopyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23611145 |
| Molecular Formula | C16H11BrN2O3S2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | methyl 2-[(5-bromopyridine-3-carbonyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccs2)csc1NC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C16H11BrN2O3S2/c1-22-16(21)13-11(12-3-2-4-23-12)8-24-15(13)19-14(20)9-5-10(17)7-18-6-9/h2-8H,1H3,(H,19,20) |
| InChIKey | DMOSVQRFQSOYOD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|