C23H18N2O4S2 — CID 90596771
ethyl 2-[(3-pyridin-2-yloxybenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 90596771) has the molecular formula C23H18N2O4S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl 2-[(3-pyridin-2-yloxybenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-pyridin-2-yloxybenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 90596771 |
| Molecular Formula | C23H18N2O4S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | ethyl 2-[(3-pyridin-2-yloxybenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C23H18N2O4S2/c1-2-28-23(27)20-17(18-9-6-12-30-18)14-31-22(20)25-21(26)15-7-5-8-16(13-15)29-19-10-3-4-11-24-19/h3-14H,2H2,1H3,(H,25,26) |
| InChIKey | NGFBEMGOOHBMCJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|