C15H18N2O3S2 — CID 82034031
ethyl 2-(4-aminobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 82034031) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is ethyl 2-(4-aminobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(4-aminobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 82034031 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | ethyl 2-(4-aminobutanoylamino)-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CCCN |
| InChI | InChI=1S/C15H18N2O3S2/c1-2-20-15(19)13-10(11-5-4-8-21-11)9-22-14(13)17-12(18)6-3-7-16/h4-5,8-9H,2-3,6-7,16H2,1H3,(H,17,18) |
| InChIKey | KTAZVVKYVXSYOG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|