C19H17N3O5S2 — CID 166213461
ethyl 2-[[2-(2-pyrimidin-5-ylacetyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 166213461) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethyl 2-[[2-(2-pyrimidin-5-ylacetyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-pyrimidin-5-ylacetyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 166213461 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | ethyl 2-[[2-(2-pyrimidin-5-ylacetyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)COC(=O)Cc1cncnc1 |
| InChI | InChI=1S/C19H17N3O5S2/c1-2-26-19(25)17-13(14-4-3-5-28-14)10-29-18(17)22-15(23)9-27-16(24)6-12-7-20-11-21-8-12/h3-5,7-8,10-11H,2,6,9H2,1H3,(H,22,23) |
| InChIKey | RDMWDMBTPKIXIE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|