C24H25NO5S2 — CID 5032958
ethyl 2-[[2-(4-tert-butylbenzoyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 5032958) has the molecular formula C24H25NO5S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 2-[[2-(4-tert-butylbenzoyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-tert-butylbenzoyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5032958 |
| Molecular Formula | C24H25NO5S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | ethyl 2-[[2-(4-tert-butylbenzoyl)oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)COC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H25NO5S2/c1-5-29-23(28)20-17(18-7-6-12-31-18)14-32-21(20)25-19(26)13-30-22(27)15-8-10-16(11-9-15)24(2,3)4/h6-12,14H,5,13H2,1-4H3,(H,25,26) |
| InChIKey | DMSZPPGWOSNKHO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|