C21H20N2O6S3 — CID 55484502
ethyl 2-[[2-[2-(thiophene-2-carbonylamino)propanoyloxy]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 55484502) has the molecular formula C21H20N2O6S3 and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(thiophene-2-carbonylamino)propanoyloxy]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(thiophene-2-carbonylamino)propanoyloxy]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55484502 |
| Molecular Formula | C21H20N2O6S3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | ethyl 2-[[2-[2-(thiophene-2-carbonylamino)propanoyloxy]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)COC(=O)C(C)NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H20N2O6S3/c1-3-28-21(27)17-13(14-6-4-8-30-14)11-32-19(17)23-16(24)10-29-20(26)12(2)22-18(25)15-7-5-9-31-15/h4-9,11-12H,3,10H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | IYGCVWGVKYTWKD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|