C13H10F3NO3S2 — CID 895440
ethyl 4-thiophen-2-yl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate (PubChem CID 895440) has the molecular formula C13H10F3NO3S2 and a molecular weight of 349.36 g/mol. Its IUPAC name is ethyl 4-thiophen-2-yl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-thiophen-2-yl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 895440 |
| Molecular Formula | C13H10F3NO3S2 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | ethyl 4-thiophen-2-yl-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO3S2/c1-2-20-11(18)9-7(8-4-3-5-21-8)6-22-10(9)17-12(19)13(14,15)16/h3-6H,2H2,1H3,(H,17,19) |
| InChIKey | OASNRMGWHRRAIK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|