C22H20N2O4S2 — CID 112766967
ethyl 2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 112766967) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is ethyl 2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 112766967 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | ethyl 2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H20N2O4S2/c1-2-28-22(27)18-16(17-4-3-11-29-17)12-30-21(18)24-20(26)14-7-9-15(10-8-14)23-19(25)13-5-6-13/h3-4,7-13H,2,5-6H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MXVUFCOQBXXMRB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|