C21H26N2O7S2 — CID 45042461
ethyl 2-[[2-(2-methylpiperidin-1-yl)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate;oxalic acid (PubChem CID 45042461) has the molecular formula C21H26N2O7S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is ethyl 2-[[2-(2-methylpiperidin-1-yl)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate;oxalic acid.
| Compound Name | ethyl 2-[[2-(2-methylpiperidin-1-yl)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 45042461 |
| Molecular Formula | C21H26N2O7S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 2-[[2-(2-methylpiperidin-1-yl)acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CN1CCCCC1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O3S2.C2H2O4/c1-3-24-19(23)17-14(15-8-6-10-25-15)12-26-18(17)20-16(22)11-21-9-5-4-7-13(21)2;3-1(4)2(5)6/h6,8,10,12-13H,3-5,7,9,11H2,1-2H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | AQYAGJIYKYQHDU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|