C19H22N2O4S2 — CID 7791884
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 7791884) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7791884 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1scc(-c2cccs2)c1C(=O)OCC(=O)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-12-5-3-7-21(9-12)16(23)10-25-19(24)17-14(15-6-4-8-26-15)11-27-18(17)20-13(2)22/h4,6,8,11-12H,3,5,7,9-10H2,1-2H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | VLTKUOAXGOHHHZ-GFCCVEGCSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|