C21H26N2O5S2 — CID 5131629
ethyl 1-[2-[(3-ethoxycarbonyl-4-thiophen-2-ylthiophen-2-yl)amino]-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 5131629) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 1-[2-[(3-ethoxycarbonyl-4-thiophen-2-ylthiophen-2-yl)amino]-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(3-ethoxycarbonyl-4-thiophen-2-ylthiophen-2-yl)amino]-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 5131629 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | ethyl 1-[2-[(3-ethoxycarbonyl-4-thiophen-2-ylthiophen-2-yl)amino]-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CN1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C21H26N2O5S2/c1-3-27-20(25)14-7-9-23(10-8-14)12-17(24)22-19-18(21(26)28-4-2)15(13-30-19)16-6-5-11-29-16/h5-6,11,13-14H,3-4,7-10,12H2,1-2H3,(H,22,24) |
| InChIKey | DSNKIPCBKKVPGF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|