C20H27N3O5S3 — CID 55853038
ethyl 2-[[2-[3-(methanesulfonamidomethyl)piperidin-1-yl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 55853038) has the molecular formula C20H27N3O5S3 and a molecular weight of 485.65 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(methanesulfonamidomethyl)piperidin-1-yl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(methanesulfonamidomethyl)piperidin-1-yl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55853038 |
| Molecular Formula | C20H27N3O5S3 |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | ethyl 2-[[2-[3-(methanesulfonamidomethyl)piperidin-1-yl]acetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)CN1CCCC(CNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C20H27N3O5S3/c1-3-28-20(25)18-15(16-7-5-9-29-16)13-30-19(18)22-17(24)12-23-8-4-6-14(11-23)10-21-31(2,26)27/h5,7,9,13-14,21H,3-4,6,8,10-12H2,1-2H3,(H,22,24) |
| InChIKey | JYEHXOGENKADEB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|