C19H16FNO4S2 — CID 7791799
2-(2-fluorophenoxy)ethyl 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 7791799) has the molecular formula C19H16FNO4S2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7791799 |
| Molecular Formula | C19H16FNO4S2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-acetamido-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1scc(-c2cccs2)c1C(=O)OCCOc1ccccc1F |
| InChI | InChI=1S/C19H16FNO4S2/c1-12(22)21-18-17(13(11-27-18)16-7-4-10-26-16)19(23)25-9-8-24-15-6-3-2-5-14(15)20/h2-7,10-11H,8-9H2,1H3,(H,21,22) |
| InChIKey | ORHZWIQXBLVGPM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|