About 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate
2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate (PubChem CID 4804285) has the molecular formula C17H16FNO4
and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate.
Molecular Properties
| Compound Name | 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate |
| PubChem CID | 4804285 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FNO4/c1-12(20)19-14-8-6-13(7-9-14)17(21)23-11-10-22-16-5-3-2-4-15(16)18/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | BYNPCSZGYYVFOO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate?
The IUPAC name of 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate (CID 4804285) is 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate.
What is the SMILES notation for 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate?
The canonical SMILES for 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate is CC(=O)Nc1ccc(C(=O)OCCOc2ccccc2F)cc1.
What is the InChIKey of 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate?
The InChIKey is BYNPCSZGYYVFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO4/c1-12(20)19-14-8-6-13(7-9-14)17(21)23-11-10-22-16-5-3-2-4-15(16)18/h2-9H,10-11H2,1H3,(H,19,20).
What are the key properties of 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate?
2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate has a molecular weight of 317.32 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenoxy)ethyl 4-acetamidobenzoate is sourced from PubChem (CID 4804285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).