C21H26FN2O4+ — CID 8961515
diethyl-[2-[4-[[2-(2-fluorophenoxy)acetyl]amino]benzoyl]oxyethyl]azanium (PubChem CID 8961515) has the molecular formula C21H26FN2O4+ and a molecular weight of 389.45 g/mol. Its IUPAC name is diethyl-[2-[4-[[2-(2-fluorophenoxy)acetyl]amino]benzoyl]oxyethyl]azanium.
| Compound Name | diethyl-[2-[4-[[2-(2-fluorophenoxy)acetyl]amino]benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 8961515 |
| Molecular Formula | C21H26FN2O4+ |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | diethyl-[2-[4-[[2-(2-fluorophenoxy)acetyl]amino]benzoyl]oxyethyl]azanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(NC(=O)COc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H25FN2O4/c1-3-24(4-2)13-14-27-21(26)16-9-11-17(12-10-16)23-20(25)15-28-19-8-6-5-7-18(19)22/h5-12H,3-4,13-15H2,1-2H3,(H,23,25)/p+1 |
| InChIKey | HWKCEECDSNWAHD-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |