C26H29N2O4+ — CID 2542662
diethyl-[2-[4-[(2-phenoxybenzoyl)amino]benzoyl]oxyethyl]azanium (PubChem CID 2542662) has the molecular formula C26H29N2O4+ and a molecular weight of 433.53 g/mol. Its IUPAC name is diethyl-[2-[4-[(2-phenoxybenzoyl)amino]benzoyl]oxyethyl]azanium.
| Compound Name | diethyl-[2-[4-[(2-phenoxybenzoyl)amino]benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 2542662 |
| Molecular Formula | C26H29N2O4+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | diethyl-[2-[4-[(2-phenoxybenzoyl)amino]benzoyl]oxyethyl]azanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(NC(=O)c2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-3-28(4-2)18-19-31-26(30)20-14-16-21(17-15-20)27-25(29)23-12-8-9-13-24(23)32-22-10-6-5-7-11-22/h5-17H,3-4,18-19H2,1-2H3,(H,27,29)/p+1 |
| InChIKey | JPBARRFKTIHKHJ-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |