C22H29N2O4+ — CID 8961513
diethyl-[2-[4-[[2-(3-methylphenoxy)acetyl]amino]benzoyl]oxyethyl]azanium (PubChem CID 8961513) has the molecular formula C22H29N2O4+ and a molecular weight of 385.48 g/mol. Its IUPAC name is diethyl-[2-[4-[[2-(3-methylphenoxy)acetyl]amino]benzoyl]oxyethyl]azanium.
| Compound Name | diethyl-[2-[4-[[2-(3-methylphenoxy)acetyl]amino]benzoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 8961513 |
| Molecular Formula | C22H29N2O4+ |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | diethyl-[2-[4-[[2-(3-methylphenoxy)acetyl]amino]benzoyl]oxyethyl]azanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(NC(=O)COc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-4-24(5-2)13-14-27-22(26)18-9-11-19(12-10-18)23-21(25)16-28-20-8-6-7-17(3)15-20/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,23,25)/p+1 |
| InChIKey | AWCSBEVSJARBNA-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |