C17H22N2O5 — CID 40621086
(E)-4-[4-[2-(diethylazaniumyl)ethoxycarbonyl]anilino]-4-oxobut-2-enoate (PubChem CID 40621086) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (E)-4-[4-[2-(diethylazaniumyl)ethoxycarbonyl]anilino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[4-[2-(diethylazaniumyl)ethoxycarbonyl]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 40621086 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (E)-4-[4-[2-(diethylazaniumyl)ethoxycarbonyl]anilino]-4-oxobut-2-enoate |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(NC(=O)/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O5/c1-3-19(4-2)11-12-24-17(23)13-5-7-14(8-6-13)18-15(20)9-10-16(21)22/h5-10H,3-4,11-12H2,1-2H3,(H,18,20)(H,21,22)/b10-9+ |
| InChIKey | DTVXJINHUJSUDF-MDZDMXLPSA-N |
| XLogP | -0.99 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|