C19H18BrNO3 — CID 2930689
propyl 4-[3-(4-bromophenyl)prop-2-enoylamino]benzoate (PubChem CID 2930689) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is propyl 4-[3-(4-bromophenyl)prop-2-enoylamino]benzoate.
| Compound Name | propyl 4-[3-(4-bromophenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 2930689 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | propyl 4-[3-(4-bromophenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H18BrNO3/c1-2-13-24-19(23)15-6-10-17(11-7-15)21-18(22)12-5-14-3-8-16(20)9-4-14/h3-12H,2,13H2,1H3,(H,21,22) |
| InChIKey | ABTMYPBCTYWOKX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|