C22H26N2O4 — CID 84552548
2-(diethylamino)ethyl 4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 84552548) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 84552548 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-3-24(4-2)15-16-28-22(27)18-8-10-19(11-9-18)23-21(26)14-7-17-5-12-20(25)13-6-17/h5-14,25H,3-4,15-16H2,1-2H3,(H,23,26)/b14-7+ |
| InChIKey | XKYIHFNWUBGVEB-VGOFMYFVSA-N |
| XLogP | 3.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|