C24H29N3O3S — CID 71833542
2-(diethylamino)ethyl 4-[3-(4-methylphenyl)prop-2-enoylcarbamothioylamino]benzoate (PubChem CID 71833542) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-(4-methylphenyl)prop-2-enoylcarbamothioylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[3-(4-methylphenyl)prop-2-enoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 71833542 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-(4-methylphenyl)prop-2-enoylcarbamothioylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=S)NC(=O)C=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-27(5-2)16-17-30-23(29)20-11-13-21(14-12-20)25-24(31)26-22(28)15-10-19-8-6-18(3)7-9-19/h6-15H,4-5,16-17H2,1-3H3,(H2,25,26,28,31) |
| InChIKey | FGHPPDDJULEBQJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|