C19H28N2O5 — CID 178072250
6-[4-[2-(diethylamino)ethoxycarbonyl]anilino]-6-oxohexanoic acid (PubChem CID 178072250) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 6-[4-[2-(diethylamino)ethoxycarbonyl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[4-[2-(diethylamino)ethoxycarbonyl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 178072250 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 6-[4-[2-(diethylamino)ethoxycarbonyl]anilino]-6-oxohexanoic acid |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C19H28N2O5/c1-3-21(4-2)13-14-26-19(25)15-9-11-16(12-10-15)20-17(22)7-5-6-8-18(23)24/h9-12H,3-8,13-14H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | XLYWBHGSJHABLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|