C22H27ClN2O4 — CID 108789465
2-(diethylamino)ethyl 4-[3-(2-chlorophenoxy)propanoylamino]benzoate (PubChem CID 108789465) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-(2-chlorophenoxy)propanoylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[3-(2-chlorophenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 108789465 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-(2-chlorophenoxy)propanoylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O4/c1-3-25(4-2)14-16-29-22(27)17-9-11-18(12-10-17)24-21(26)13-15-28-20-8-6-5-7-19(20)23/h5-12H,3-4,13-16H2,1-2H3,(H,24,26) |
| InChIKey | RLNPKCOIRMKDNY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |