C20H26N4O5 — CID 108788712
2-(diethylamino)ethyl 4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate (PubChem CID 108788712) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 108788712 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CCn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H26N4O5/c1-3-23(4-2)13-14-29-19(27)15-5-7-16(8-6-15)21-17(25)9-11-24-12-10-18(26)22-20(24)28/h5-8,10,12H,3-4,9,11,13-14H2,1-2H3,(H,21,25)(H,22,26,28) |
| InChIKey | GMFYHJQAAKUACF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |