C26H28FN3O4S2 — CID 4757234
2-(diethylamino)ethyl 4-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 4757234) has the molecular formula C26H28FN3O4S2 and a molecular weight of 529.66 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 4757234 |
| Molecular Formula | C26H28FN3O4S2 |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-[5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CCN2C(=O)C(=Cc3ccccc3F)SC2=S)cc1 |
| InChI | InChI=1S/C26H28FN3O4S2/c1-3-29(4-2)15-16-34-25(33)18-9-11-20(12-10-18)28-23(31)13-14-30-24(32)22(36-26(30)35)17-19-7-5-6-8-21(19)27/h5-12,17H,3-4,13-16H2,1-2H3,(H,28,31) |
| InChIKey | KQPDCWPZYXMWFS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|