C23H23FN2O3S2 — CID 16630886
6-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide (PubChem CID 16630886) has the molecular formula C23H23FN2O3S2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 6-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide.
| Compound Name | 6-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 16630886 |
| Molecular Formula | C23H23FN2O3S2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 6-[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
| SMILES | COc1ccc(NC(=O)CCCCCN2C(=O)/C(=C/c3ccccc3F)SC2=S)cc1 |
| InChI | InChI=1S/C23H23FN2O3S2/c1-29-18-12-10-17(11-13-18)25-21(27)9-3-2-6-14-26-22(28)20(31-23(26)30)15-16-7-4-5-8-19(16)24/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3,(H,25,27)/b20-15- |
| InChIKey | YTYQJHXBTIXJNG-HKWRFOASSA-N |
| XLogP | 5.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|