C32H36N4O6S4 — CID 4756413
6-[5-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide (PubChem CID 4756413) has the molecular formula C32H36N4O6S4 and a molecular weight of 700.93 g/mol. Its IUPAC name is 6-[5-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide.
| Compound Name | 6-[5-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 4756413 |
| Molecular Formula | C32H36N4O6S4 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 700.15 |
| IUPAC Name | 6-[5-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
| SMILES | COc1ccc(NC(=O)CCCCCN2C(=O)C(=C3SC(=S)N(CCCCCC(=O)Nc4ccc(OC)cc4)C3=O)SC2=S)cc1 |
| InChI | InChI=1S/C32H36N4O6S4/c1-41-23-15-11-21(12-16-23)33-25(37)9-5-3-7-19-35-29(39)27(45-31(35)43)28-30(40)36(32(44)46-28)20-8-4-6-10-26(38)34-22-13-17-24(42-2)18-14-22/h11-18H,3-10,19-20H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | FAIZJJXUDOOCPZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|