C25H27N3O5S2 — CID 4757848
2-(dimethylamino)ethyl 4-[3-[5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 4757848) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-[3-[5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | 2-(dimethylamino)ethyl 4-[3-[5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 4757848 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-[3-[5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | COc1ccccc1C=C1SC(=S)N(CCC(=O)Nc2ccc(C(=O)OCCN(C)C)cc2)C1=O |
| InChI | InChI=1S/C25H27N3O5S2/c1-27(2)14-15-33-24(31)17-8-10-19(11-9-17)26-22(29)12-13-28-23(30)21(35-25(28)34)16-18-6-4-5-7-20(18)32-3/h4-11,16H,12-15H2,1-3H3,(H,26,29) |
| InChIKey | VYNZTZGQCIZZAD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|