C27H31N3O4S2 — CID 6203242
2-(dimethylamino)ethyl 4-[6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate (PubChem CID 6203242) has the molecular formula C27H31N3O4S2 and a molecular weight of 525.70 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-[6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate.
| Compound Name | 2-(dimethylamino)ethyl 4-[6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
|---|---|
| PubChem CID | 6203242 |
| Molecular Formula | C27H31N3O4S2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-[6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]benzoate |
| SMILES | CN(C)CCOC(=O)c1ccc(NC(=O)CCCCCN2C(=O)/C(=C/c3ccccc3)SC2=S)cc1 |
| InChI | InChI=1S/C27H31N3O4S2/c1-29(2)17-18-34-26(33)21-12-14-22(15-13-21)28-24(31)11-7-4-8-16-30-25(32)23(36-27(30)35)19-20-9-5-3-6-10-20/h3,5-6,9-10,12-15,19H,4,7-8,11,16-18H2,1-2H3,(H,28,31)/b23-19- |
| InChIKey | VJPGJVYILQIDDC-NMWGTECJSA-N |
| XLogP | 4.81 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|