C26H27N3O4S2 — CID 6531736
2-(dimethylamino)ethyl 4-[[2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 6531736) has the molecular formula C26H27N3O4S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-[[2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | 2-(dimethylamino)ethyl 4-[[2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 6531736 |
| Molecular Formula | C26H27N3O4S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-[[2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CC(/C=C1\SC(=S)N(CC(=O)Nc2ccc(C(=O)OCCN(C)C)cc2)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4S2/c1-18(15-19-7-5-4-6-8-19)16-22-24(31)29(26(34)35-22)17-23(30)27-21-11-9-20(10-12-21)25(32)33-14-13-28(2)3/h4-12,15-16H,13-14,17H2,1-3H3,(H,27,30)/b18-15+,22-16- |
| InChIKey | DNDKZWJXTXIFJP-RCYLNMRYSA-N |
| XLogP | 4.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|