C21H26N2O3S2 — CID 6531708
2-(dimethylamino)ethyl 4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 6531708) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | 2-(dimethylamino)ethyl 4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 6531708 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CC(/C=C1\SC(=S)N(CCCC(=O)OCCN(C)C)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-16(14-17-8-5-4-6-9-17)15-18-20(25)23(21(27)28-18)11-7-10-19(24)26-13-12-22(2)3/h4-6,8-9,14-15H,7,10-13H2,1-3H3/b16-14+,18-15- |
| InChIKey | GYPRGJDGABKNGR-BEQKSFQUSA-N |
| XLogP | 3.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|