C25H27N3O4S2 — CID 6379689
2-(diethylamino)ethyl 4-[[2-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 6379689) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[2-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[2-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 6379689 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[2-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CN2C(=O)/C(=C\c3ccccc3)SC2=S)cc1 |
| InChI | InChI=1S/C25H27N3O4S2/c1-3-27(4-2)14-15-32-24(31)19-10-12-20(13-11-19)26-22(29)17-28-23(30)21(34-25(28)33)16-18-8-6-5-7-9-18/h5-13,16H,3-4,14-15,17H2,1-2H3,(H,26,29)/b21-16+ |
| InChIKey | RZRINMIJCXBOOQ-LTGZKZEYSA-N |
| XLogP | 4.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|